4-Methyl-6-phenylpyrimidin-2-amine
Catalog No: FT-0679106
CAS No: 15755-15-4
- Chemical Name: 4-Methyl-6-phenylpyrimidin-2-amine
- Molecular Formula: C11H11N3
- Molecular Weight: 185.22
- InChI Key: ZWHPURVKWJBWEF-UHFFFAOYSA-N
- InChI: InChI=1S/C11H11N3/c1-8-7-10(14-11(12)13-8)9-5-3-2-4-6-9/h2-7H,1H3,(H2,12,13,14)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Danger |
|---|---|
| FW: | 185.22500 |
| Density: | 1.159g/cm3 |
| CAS: | 15755-15-4 |
| Bolling_Point: | 400ºC at 760 mmHg |
| Product_Name: | 4-Methyl-6-phenylpyrimidin-2-amine |
| Melting_Point: | N/A |
| Flash_Point: | 224.5ºC |
| MF: | C11H11N3 |
| Density: | 1.159g/cm3 |
|---|---|
| LogP: | 2.61540 |
| Flash_Point: | 224.5ºC |
| Refractive_Index: | 1.619 |
| FW: | 185.22500 |
| PSA: | 51.80000 |
| MF: | C11H11N3 |
| Bolling_Point: | 400ºC at 760 mmHg |
| Vapor_Pressure: | 1.31E-06mmHg at 25°C |
| Exact_Mass: | 185.09500 |
| Warning_Statement: | P280-P305 + P351 + P338 |
|---|---|
| Safety_Statements: | H302-H318 |
| Symbol: | Danger |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933599090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)